CAS 365413-00-9 is the registry number for 2-[1-(tert-Butoxycarbonyl)-4-piperidinyl]-1,3-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-4-carboxylic acid (CAS 365413-00-9) is a chemical compound with the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-4-carboxylic acid. InChIKey: KIRRXZPLONWSFO-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O4S |
|---|---|
| Molecular weight | 312.39 g/mol |
| IUPAC name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | KIRRXZPLONWSFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)