Products 77266-65-0
CAS 77266-65-0 appears in our catalog under these names: 5-[(Dimethylamino)sulfonyl]-2-piperidin-1-ylbenzoic acid, 95%, 5-(Dimethylsulfamoyl)-2-(piperidin-1-yl)benzoic acid, 95%, 5-(Dimethylsulfamoyl)-2-(piperidin-1-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 2,5g.
5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoic acid (CAS 77266-65-0) is a chemical compound with the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. IUPAC name: 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoic acid. InChIKey: ATFRGLNGURZGBY-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O4S |
|---|---|
| Molecular weight | 312.39 g/mol |
| IUPAC name | 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoic acid |
| InChIKey | ATFRGLNGURZGBY-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)N2CCCCC2)C(=O)O |
Computed by PubChem (NCBI)