Products 73297-49-1
CAS 73297-49-1 appears in our catalog under these names: M-Toluidine hemisulfate, 95%, m–toluidine hemisulfate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 25g.
Bis((3-methylphenyl)azanium);sulfate (CAS 73297-49-1) is a chemical compound with the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. IUPAC name: bis((3-methylphenyl)azanium);sulfate. InChIKey: ZVNDLRVDJSIWRR-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O4S |
|---|---|
| Molecular weight | 312.39 g/mol |
| IUPAC name | bis((3-methylphenyl)azanium);sulfate |
| InChIKey | ZVNDLRVDJSIWRR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)[NH3+].CC1=CC(=CC=C1)[NH3+].[O-]S(=O)(=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Bis(3-methylanilinium) sulfate