cas: 79996-90-0 — see every product listed under this CAS number, including other names
4-(Hydroxymethyl)-1-naphthonitrile, 95% (CAS 79996-90-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F457616-100MG |
| cas | 79996-90-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 5g | 4725.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(hydroxymethyl)naphthalene-1-carbonitrile (CAS 79996-90-0) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 4-(hydroxymethyl)naphthalene-1-carbonitrile. InChIKey: PZKDOSHWQBLVJW-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 4-(hydroxymethyl)naphthalene-1-carbonitrile |
| InChIKey | PZKDOSHWQBLVJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=CC=C(C2=C1)CO)C#N |
Computed by PubChem (NCBI)