cas: 13205-50-0 — see every product listed under this CAS number, including other names
4-(Isopropylthio)benzoic acid 95% (CAS 13205-50-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A658708-250mg |
| cas | 13205-50-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2345.06 Pln | |
| Ambeed | 10g | 3524.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A658708 |
4-propan-2-ylsulfanylbenzoic acid (CAS 13205-50-0) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: 4-propan-2-ylsulfanylbenzoic acid. InChIKey: CPQZLTQBBLQRIN-UHFFFAOYSA-N.
| Molecular formula | C10H12O2S |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 4-propan-2-ylsulfanylbenzoic acid |
| InChIKey | CPQZLTQBBLQRIN-UHFFFAOYSA-N |
| SMILES | CC(C)SC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)