Products 13205-50-0
CAS 13205-50-0 appears in our catalog under these names: 4-(Isopropylsulfanyl)benzoic acid, 96%, 4-(Isopropylthio)benzoic acid, 96%, 4-(Isopropylsulfanyl)benzoic acid, 4-(Isopropylthio)benzoic acid 95%, 4-(Isopropylsulfanyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 0,5g, 250mg, 50mg, 100mg.
4-propan-2-ylsulfanylbenzoic acid (CAS 13205-50-0) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: 4-propan-2-ylsulfanylbenzoic acid. InChIKey: CPQZLTQBBLQRIN-UHFFFAOYSA-N.
| Molecular formula | C10H12O2S |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 4-propan-2-ylsulfanylbenzoic acid |
| InChIKey | CPQZLTQBBLQRIN-UHFFFAOYSA-N |
| SMILES | CC(C)SC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)