4-(Methylsulfonylamino)phenylboronic acid, 95%
cas: 380430-57-9 — see every product listed under this CAS number, including other names
4-(Methylsulfonylamino)phenylboronic acid, 95% (CAS 380430-57-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1148ID-100mg |
| cas | 380430-57-9 |
| size | 100mg |
| availability | 75g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 731.60 Pln | |
| Chemat | 10g | 1274.00 Pln | |
| Chemat | 25g | 2546.00 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 804.94 Pln | |
| Fluorochem | 10g | 1554.68 Pln | |
| Fluorochem | 25g | 3652.90 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(methanesulfonamido)phenyl]boronic acid (CAS 380430-57-9) is a chemical compound with the molecular formula C7H10BNO4S and a molecular weight of 215.04 g/mol. IUPAC name: [4-(methanesulfonamido)phenyl]boronic acid. InChIKey: NDVJJEADFLTFCD-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4S |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | [4-(methanesulfonamido)phenyl]boronic acid |
| InChIKey | NDVJJEADFLTFCD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NS(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-methanesulfonamidophenyl)boronic Acid, [4-(Methylsulfonamido)phenyl]boronic acid, 4-(Methylsulfonylamino)phenylboronic acid, [4-(methanesulfonamido)phenyl]boronic acid, 4-(Methylsulfonamido)phenylboronic Acid, 4-Methanesulfonylaminophenylboronic acid, 4-(Methanesulfonylamino)phenylboronic acid, 4-[(Methylsulphonyl)amino]benzeneboronic acid, 4-(Methylsulfonylamino)phenylboronicacid, {4-[(methylsulfonyl)amino]phenyl}boronic acid