CAS 380430-57-9 appears in our catalog under these names: N-4-Methanesulfonamidephenylboronic acid/ 95+%, 4-(Methanesulfonamido)phenylboronic acid, 97%, N-4-METHANESULFONAMIDEPHENYLBORONIC ACID, 4-(METHYLSULFONYLAMINO)PHENYLBORONIC ACID, 98%, 98%, 4-(Methylsulfonylamino)phenylboronic acid, 95%. Offered by: Chemat, Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
[4-(methanesulfonamido)phenyl]boronic acid (CAS 380430-57-9) is a chemical compound with the molecular formula C7H10BNO4S and a molecular weight of 215.04 g/mol. IUPAC name: [4-(methanesulfonamido)phenyl]boronic acid. InChIKey: NDVJJEADFLTFCD-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4S |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | [4-(methanesulfonamido)phenyl]boronic acid |
| InChIKey | NDVJJEADFLTFCD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NS(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)