cas: 194017-69-1 — see every product listed under this CAS number, including other names
4-(Pyridin-2-yloxy)benzaldehyde 98% (CAS 194017-69-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A419597-250mg |
| cas | 194017-69-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A419597 |
4-pyridin-2-yloxybenzaldehyde (CAS 194017-69-1) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 4-pyridin-2-yloxybenzaldehyde. InChIKey: DPRZACGKYIDYCK-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 4-pyridin-2-yloxybenzaldehyde |
| InChIKey | DPRZACGKYIDYCK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)