CAS 40070-84-6 is the registry number for 2-(2-Quinolyl)malondialdehyde, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
2-quinolin-2-ylpropanedial (CAS 40070-84-6) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 2-quinolin-2-ylpropanedial. InChIKey: BGCDOBZPKOBWHE-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-quinolin-2-ylpropanedial |
| InChIKey | BGCDOBZPKOBWHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C(C=O)C=O |
Computed by PubChem (NCBI)