cas: 30235-27-9 — see every product listed under this CAS number, including other names
4-(Pyridin-3-yl)thiazol-2-amine, 97%, 97% (CAS 30235-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZC0-100mg |
| cas | 30235-27-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 501.20 Pln | |
| Chemat | 25g | 1898.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-pyridin-3-yl-1,3-thiazol-2-amine (CAS 30235-27-9) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 4-pyridin-3-yl-1,3-thiazol-2-amine. InChIKey: XOHZQGAYUHOJPR-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 4-pyridin-3-yl-1,3-thiazol-2-amine |
| InChIKey | XOHZQGAYUHOJPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)