CAS 27182-54-3 appears in our catalog under these names: 5-Phenyl-1,2,4-thiadiazol-3-amine, 5-Phenyl-1,2,4-thiadiazol-3-amine, 95%, 5-Phenyl-1,2,4-thiadiazol-3-amine, 97%, 3-Amino-5-phenyl-1,2,4-thiadiazole, 96% . Offered by: Fluorochem, Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
5-phenyl-1,2,4-thiadiazol-3-amine (CAS 27182-54-3) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,2,4-thiadiazol-3-amine. InChIKey: WOZDQVLZCXNJPY-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,2,4-thiadiazol-3-amine |
| InChIKey | WOZDQVLZCXNJPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NS2)N |
Computed by PubChem (NCBI)