CAS 17467-15-1 appears in our catalog under these names: 3-Phenyl-1,2,4-thiadiazol-5-amine, 95%, 5-Amino-3-phenyl-1,2,4-thiadiazole, 98%. Offered by: Combi-blocks, Chemat Brand, Fluorochem. Available pack sizes: 5g, 1g, on request, 25g, 100g.
3-phenyl-1,2,4-thiadiazol-5-amine (CAS 17467-15-1) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 3-phenyl-1,2,4-thiadiazol-5-amine. InChIKey: OYAHSBDYBOBAAQ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 3-phenyl-1,2,4-thiadiazol-5-amine |
| InChIKey | OYAHSBDYBOBAAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=N2)N |
Computed by PubChem (NCBI)