CAS 2002-03-1 appears in our catalog under these names: 5-Phenyl-1,3,4-thiadiazol-2-amine, 98%, 2-Amino-5-phenyl-1,3,4-thiadiazole, 97% , 2-Amino-5-phenyl-1,3,4-thiadiazol, >98.0%(HPLC)(T), 2-AMINO-5-PHENYL-1,3,4-THIADIAZOLE, 96%, 1,3,4-Thiadiazol-2-amine, 5-phenyl-, 96%, 96%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 250mg.
5-phenyl-1,3,4-thiadiazol-2-amine (CAS 2002-03-1) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,3,4-thiadiazol-2-amine. InChIKey: UHZHEOAEJRHUBW-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,3,4-thiadiazol-2-amine |
| InChIKey | UHZHEOAEJRHUBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)