cas: 13296-04-3 — see every product listed under this CAS number, including other names
4-(Pyridin-4-yl)aniline, >98.0%(HPLC)(T) (CAS 13296-04-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2782-1G |
| cas | 13296-04-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 747.75 Pln | |
| TCI | 5g | 2498.29 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
4-pyridin-4-ylaniline (CAS 13296-04-3) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 4-pyridin-4-ylaniline. InChIKey: GKVYVZSNXXTOMQ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4-pyridin-4-ylaniline |
| InChIKey | GKVYVZSNXXTOMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)N |
Computed by PubChem (NCBI)