cas: 13296-04-3 — see every product listed under this CAS number, including other names
4-(Pyridin-4-yl)aniline, 97%, 97% (CAS 13296-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1122GB-100mg |
| cas | 13296-04-3 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 563.60 Pln | |
| Chemat | 25g | 2003.60 Pln | |
| Chemat | 10g | 1000.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-pyridin-4-ylaniline (CAS 13296-04-3) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 4-pyridin-4-ylaniline. InChIKey: GKVYVZSNXXTOMQ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4-pyridin-4-ylaniline |
| InChIKey | GKVYVZSNXXTOMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)N |
Computed by PubChem (NCBI)