cas: 1227187-82-7 — see every product listed under this CAS number, including other names
4-(TRIFLUOROMETHOXY)CYCLOHEXANECARBOXYLIC ACID, 97%, 97% (CAS 1227187-82-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HGW9-100mg |
| cas | 1227187-82-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1235.60 Pln | |
| Chemat | 250mg | 1931.60 Pln | |
| Chemat | 500mg | 3179.60 Pln | |
| Chemat | 1g | 4734.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethoxy)cyclohexane-1-carboxylic acid (CAS 1227187-82-7) is a chemical compound with the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. IUPAC name: 4-(trifluoromethoxy)cyclohexane-1-carboxylic acid. InChIKey: QGMWMYHMLLIPMI-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O3 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 4-(trifluoromethoxy)cyclohexane-1-carboxylic acid |
| InChIKey | QGMWMYHMLLIPMI-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)