cas: 1227187-82-7 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)cyclohexanecarboxylic acid, 97% (CAS 1227187-82-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A200703-5g |
| cas | 1227187-82-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 22757.35 Pln | |
| Fluorochem | 100mg | 2018.06 Pln | |
| Fluorochem | 250mg | 3168.69 Pln | |
| Fluorochem | 500mg | 5235.67 Pln | |
| Fluorochem | 1g | 7818.10 Pln | |
| Fluorochem | 5g | 23307.44 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(trifluoromethoxy)cyclohexane-1-carboxylic acid (CAS 1227187-82-7) is a chemical compound with the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. IUPAC name: 4-(trifluoromethoxy)cyclohexane-1-carboxylic acid. InChIKey: QGMWMYHMLLIPMI-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O3 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 4-(trifluoromethoxy)cyclohexane-1-carboxylic acid |
| InChIKey | QGMWMYHMLLIPMI-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)