cas: 37519-09-8 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)benzene-1,2-diol, 98%, 98% (CAS 37519-09-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8E7-100mg |
| cas | 37519-09-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 798.80 Pln | |
| Chemat | 1g | 1595.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethyl)benzene-1,2-diol (CAS 37519-09-8) is a chemical compound with the molecular formula C7H5F3O2 and a molecular weight of 178.11 g/mol. IUPAC name: 4-(trifluoromethyl)benzene-1,2-diol. InChIKey: RZFLJQHPAGLLPF-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O2 |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzene-1,2-diol |
| InChIKey | RZFLJQHPAGLLPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)O |
Computed by PubChem (NCBI)