cas: 37519-09-8 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)benzene-1,2-diol, 98% (CAS 37519-09-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A423346-5g |
| cas | 37519-09-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11052.37 Pln | |
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 250mg | 976.76 Pln | |
| Fluorochem | 1g | 2346.07 Pln | |
| Fluorochem | 5g | 6891.34 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(trifluoromethyl)benzene-1,2-diol (CAS 37519-09-8) is a chemical compound with the molecular formula C7H5F3O2 and a molecular weight of 178.11 g/mol. IUPAC name: 4-(trifluoromethyl)benzene-1,2-diol. InChIKey: RZFLJQHPAGLLPF-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O2 |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzene-1,2-diol |
| InChIKey | RZFLJQHPAGLLPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)O |
Computed by PubChem (NCBI)