cas: 2991-42-6 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)benzenesulfonyl Chloride, >98.0%(GC)(T) (CAS 2991-42-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1795-1G |
| cas | 2991-42-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 193.59 Pln | |
| TCI | 5g | 405.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
4-(trifluoromethyl)benzenesulfonyl chloride (CAS 2991-42-6) is a chemical compound with the molecular formula C7H4ClF3O2S and a molecular weight of 244.62 g/mol. IUPAC name: 4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: OZDCZHDOIBUGAJ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2S |
|---|---|
| Molecular weight | 244.62 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | OZDCZHDOIBUGAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)