cas: 2991-42-6 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)benzenesulfonyl chloride, 96% (CAS 2991-42-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007589-5G |
| cas | 2991-42-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 81.24 Pln | |
| Fluorochem | 10g | 91.65 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 310.33 Pln | |
| Fluorochem | 500g | 1174.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4-(trifluoromethyl)benzenesulfonyl chloride (CAS 2991-42-6) is a chemical compound with the molecular formula C7H4ClF3O2S and a molecular weight of 244.62 g/mol. IUPAC name: 4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: OZDCZHDOIBUGAJ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2S |
|---|---|
| Molecular weight | 244.62 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | OZDCZHDOIBUGAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)