cas: 1261813-10-8 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)isoindolin-1-one, 97% (CAS 1261813-10-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F331964-100MG |
| cas | 1261813-10-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 2950.02 Pln | |
| Fluorochem | 10g | 5693.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-(trifluoromethyl)-2,3-dihydroisoindol-1-one (CAS 1261813-10-8) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 4-(trifluoromethyl)-2,3-dihydroisoindol-1-one. InChIKey: UYOAUXNGRMUPJJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 4-(trifluoromethyl)-2,3-dihydroisoindol-1-one |
| InChIKey | UYOAUXNGRMUPJJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2C(F)(F)F)C(=O)N1 |
Computed by PubChem (NCBI)