cas: 22253-59-4 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)pyridine 1-oxide 95% (CAS 22253-59-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A636698-250mg |
| cas | 22253-59-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 2117.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A636698 |
1-oxido-4-(trifluoromethyl)pyridin-1-ium (CAS 22253-59-4) is a chemical compound with the molecular formula C6H4F3NO and a molecular weight of 163.10 g/mol. IUPAC name: 1-oxido-4-(trifluoromethyl)pyridin-1-ium. InChIKey: WDUUZHQOZHEULL-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO |
|---|---|
| Molecular weight | 163.10 g/mol |
| IUPAC name | 1-oxido-4-(trifluoromethyl)pyridin-1-ium |
| InChIKey | WDUUZHQOZHEULL-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C(F)(F)F)[O-] |
Computed by PubChem (NCBI)