cas: 22253-59-4 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)pyridine 1-oxide (CAS 22253-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F403462-100MG |
| cas | 22253-59-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 1138.16 Pln | |
| Fluorochem | 5g | 3423.81 Pln |
| delivery time | 3-4 weeks |
|---|
1-oxido-4-(trifluoromethyl)pyridin-1-ium (CAS 22253-59-4) is a chemical compound with the molecular formula C6H4F3NO and a molecular weight of 163.10 g/mol. IUPAC name: 1-oxido-4-(trifluoromethyl)pyridin-1-ium. InChIKey: WDUUZHQOZHEULL-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO |
|---|---|
| Molecular weight | 163.10 g/mol |
| IUPAC name | 1-oxido-4-(trifluoromethyl)pyridin-1-ium |
| InChIKey | WDUUZHQOZHEULL-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C(F)(F)F)[O-] |
Computed by PubChem (NCBI)