cas: 51334-85-1 — see every product listed under this CAS number, including other names
4-(p-Tolyl)phthalazin-1(2H)-one, 98%, 98% (CAS 51334-85-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DG13-100mg |
| cas | 51334-85-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 126.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-methylphenyl)phthalazin-1-one (CAS 51334-85-1) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 2-(4-methylphenyl)phthalazin-1-one. InChIKey: ZJWOALHADJZGJS-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 2-(4-methylphenyl)phthalazin-1-one |
| InChIKey | ZJWOALHADJZGJS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C=N2 |
Computed by PubChem (NCBI)