cas: 67765-24-6 — see every product listed under this CAS number, including other names
4-(p-Tolyl)piperidine hydrochloride, 95% (CAS 67765-24-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A430231-10g |
| cas | 67765-24-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 11918.20 Pln | |
| AmBeed | 5g | 6840.40 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-methylphenyl)piperidine;hydrochloride (CAS 67765-24-6) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 4-(4-methylphenyl)piperidine;hydrochloride. InChIKey: ROPXDRJXVYKIPI-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 4-(4-methylphenyl)piperidine;hydrochloride |
| InChIKey | ROPXDRJXVYKIPI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2CCNCC2.Cl |
Computed by PubChem (NCBI)