cas: 870646-83-6 — see every product listed under this CAS number, including other names
4-(t-Butyldimethylsilyloxy)-2,3-difluorophenylboronic acid 98% (CAS 870646-83-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A507055-250mg |
| cas | 870646-83-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A507055 |
[4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid (CAS 870646-83-6) is a chemical compound with the molecular formula C12H19BF2O3Si and a molecular weight of 288.17 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid. InChIKey: DODXXNHIJRLFAF-UHFFFAOYSA-N.
| Molecular formula | C12H19BF2O3Si |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid |
| InChIKey | DODXXNHIJRLFAF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)O[Si](C)(C)C(C)(C)C)F)F)(O)O |
Computed by PubChem (NCBI)