Products 1150114-45-6

CAS 1150114-45-6 is the registry number for 5-(t-Butyldimethylsilyloxy)-2,3-difluorophenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

[5-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid (CAS 1150114-45-6) is a chemical compound with the molecular formula C12H19BF2O3Si and a molecular weight of 288.17 g/mol. IUPAC name: [5-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid. InChIKey: PYVUCBDNFYCJFO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19BF2O3Si
Molecular weight288.17 g/mol
IUPAC name[5-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenyl]boronic acid
InChIKeyPYVUCBDNFYCJFO-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1F)F)O[Si](C)(C)C(C)(C)C)(O)O

Computed by PubChem (NCBI)