CAS 2096341-77-2 appears in our catalog under these names: 4-(t-Butyldimethylsilyloxy)-2,6-difluorophenylboronic acid, 96%, (4-((tert-Butyldimethylsilyl)oxy)-2,6-difluorophenyl)boronic acid 98%, 4-(t-Butyldimethylsilyloxy)-2,6-difluorophenylboronic acid, 98%, 98%, 4-(TERT-BUTYLDIMETHYLSILYLOXY)-2,6-DIFLUOROPHENYLBORONIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 100mg, 250mg.
[4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid (CAS 2096341-77-2) is a chemical compound with the molecular formula C12H19BF2O3Si and a molecular weight of 288.17 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid. InChIKey: SAXLUFSXLIRBKM-UHFFFAOYSA-N.
| Molecular formula | C12H19BF2O3Si |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid |
| InChIKey | SAXLUFSXLIRBKM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)O[Si](C)(C)C(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)