CAS 2377609-56-6 is the registry number for 3-(t-Butyldimethylsilyloxy)-4,5-difluorophenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-[tert-butyl(dimethyl)silyl]oxy-4,5-difluorophenyl]boronic acid (CAS 2377609-56-6) is a chemical compound with the molecular formula C12H19BF2O3Si and a molecular weight of 288.17 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxy-4,5-difluorophenyl]boronic acid. InChIKey: OFDBQWJPHJPFJH-UHFFFAOYSA-N.
| Molecular formula | C12H19BF2O3Si |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxy-4,5-difluorophenyl]boronic acid |
| InChIKey | OFDBQWJPHJPFJH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)