4-[(2,4-Dimethylphenyl)sulfanyl]aniline hydrochloride, 95%
cas: 1049755-55-6 — see every product listed under this CAS number, including other names
4-[(2,4-Dimethylphenyl)sulfanyl]aniline hydrochloride, 95% (CAS 1049755-55-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F693129-100MG |
| cas | 1049755-55-6 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 981.96 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1488.44 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 678.80 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 447.64 Pln | |
| BLDpharm | 5g | 1597.24 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride (CAS 1049755-55-6) is a chemical compound with the molecular formula C14H16ClNS and a molecular weight of 265.8 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride. InChIKey: DLQYXWSCPPGOJA-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNS |
|---|---|
| Molecular weight | 265.8 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride |
| InChIKey | DLQYXWSCPPGOJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=C(C=C2)N)C.Cl |
Computed by PubChem (NCBI)