Products 1049762-40-4
CAS 1049762-40-4 appears in our catalog under these names: 4-((2,5-Dimethylphenyl)sulfanyl)aniline hydrochloride, 4-[(2,5-Dimethylphenyl)thio]aniline hydrochloride, 95%, 4-((2,5-Dimethylphenyl)sulfanyl)aniline hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 2,5g, 5g, 10g, 1g, 100mg.
4-(2,5-dimethylphenyl)sulfanylaniline;hydrochloride (CAS 1049762-40-4) is a chemical compound with the molecular formula C14H16ClNS and a molecular weight of 265.8 g/mol. IUPAC name: 4-(2,5-dimethylphenyl)sulfanylaniline;hydrochloride. InChIKey: WSWYBVBZRLTFRQ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNS |
|---|---|
| Molecular weight | 265.8 g/mol |
| IUPAC name | 4-(2,5-dimethylphenyl)sulfanylaniline;hydrochloride |
| InChIKey | WSWYBVBZRLTFRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)SC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)