CAS 1384430-01-6 is the registry number for 4-(1-(Phenylsulfanyl)ethyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1-phenylsulfanylethyl)aniline;hydrochloride (CAS 1384430-01-6) is a chemical compound with the molecular formula C14H16ClNS and a molecular weight of 265.8 g/mol. IUPAC name: 4-(1-phenylsulfanylethyl)aniline;hydrochloride. InChIKey: IFOBFIHITLYNLP-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNS |
|---|---|
| Molecular weight | 265.8 g/mol |
| IUPAC name | 4-(1-phenylsulfanylethyl)aniline;hydrochloride |
| InChIKey | IFOBFIHITLYNLP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)N)SC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)