CAS 1049762-60-8 appears in our catalog under these names: 4-[(3,4-Dimethylphenyl)thio]aniline hydrochloride, 95%, 4-((3,4-Dimethylphenyl)thio)aniline hydrochloride, 95%, 4-((3,4-Dimethylphenyl)sulfanyl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 2,5g.
4-(3,4-dimethylphenyl)sulfanylaniline;hydrochloride (CAS 1049762-60-8) is a chemical compound with the molecular formula C14H16ClNS and a molecular weight of 265.8 g/mol. IUPAC name: 4-(3,4-dimethylphenyl)sulfanylaniline;hydrochloride. InChIKey: YASMYLIXACCLLT-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNS |
|---|---|
| Molecular weight | 265.8 g/mol |
| IUPAC name | 4-(3,4-dimethylphenyl)sulfanylaniline;hydrochloride |
| InChIKey | YASMYLIXACCLLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)SC2=CC=C(C=C2)N)C.Cl |
Computed by PubChem (NCBI)