cas: 956189-58-5 — see every product listed under this CAS number, including other names
4-[(3aR,4S,9bS)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid, 99%, 99% (CAS 956189-58-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJ9X-1mg |
| cas | 956189-58-5 |
| size | 1mg |
| availability | 0.01g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 2099.60 Pln | |
| Chemat | 5mg | 4518.80 Pln | |
| Chemat | 10mg | 7470.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
4-[(3aR,4S,9bS)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid (CAS 956189-58-5) is a chemical compound with the molecular formula C21H21NO3 and a molecular weight of 335.4 g/mol. IUPAC name: 4-[(3aR,4S,9bS)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid. InChIKey: QWJMABCFVYELBB-FRQCXROJSA-N.
| Molecular formula | C21H21NO3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-[(3aR,4S,9bS)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| InChIKey | QWJMABCFVYELBB-FRQCXROJSA-N |
| SMILES | CCOC1=CC=CC2=C1N[C@@H]([C@H]3[C@@H]2C=CC3)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)