Products 932928-74-0
CAS 932928-74-0 appears in our catalog under these names: 2-(3-Butoxyphenyl)-6-methylquinoline-4-carboxylic acid, 95%, 2-(3-Butoxyphenyl)-6-methylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-butoxyphenyl)-6-methylquinoline-4-carboxylic acid (CAS 932928-74-0) is a chemical compound with the molecular formula C21H21NO3 and a molecular weight of 335.4 g/mol. IUPAC name: 2-(3-butoxyphenyl)-6-methylquinoline-4-carboxylic acid. InChIKey: SSRGVEWUSAPTIF-UHFFFAOYSA-N.
| Molecular formula | C21H21NO3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-(3-butoxyphenyl)-6-methylquinoline-4-carboxylic acid |
| InChIKey | SSRGVEWUSAPTIF-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)C2=NC3=C(C=C(C=C3)C)C(=C2)C(=O)O |
Computed by PubChem (NCBI)