Products 1217531-04-8
CAS 1217531-04-8 is the registry number for 2'-Benzyl-1'-oxo-1',4'-dihydro-2'h-spiro[cyclopentane-1,3'-isoquinoline]-4'-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-benzyl-1-oxospiro[4H-isoquinoline-3,1'-cyclopentane]-4-carboxylic acid (CAS 1217531-04-8) is a chemical compound with the molecular formula C21H21NO3 and a molecular weight of 335.4 g/mol. IUPAC name: 2-benzyl-1-oxospiro[4H-isoquinoline-3,1'-cyclopentane]-4-carboxylic acid. InChIKey: MOWXAAQSBVCOGG-UHFFFAOYSA-N.
| Molecular formula | C21H21NO3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-benzyl-1-oxospiro[4H-isoquinoline-3,1'-cyclopentane]-4-carboxylic acid |
| InChIKey | MOWXAAQSBVCOGG-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(C3=CC=CC=C3C(=O)N2CC4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)