Products 956189-58-5
CAS 956189-58-5 appears in our catalog under these names: LIN28 inhibitor LI71 enantiomer, 4-[(3ar,4s,9bs)-6-Ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid, 95%, LIN28 inhibitor LI71 enantiomer, 4-[(3aR,4S,9bS)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid, 99%, 99%, LIN28 inhibitor LI71 enantiomer, 99.68%. Offered by: GLPBio, Combi-blocks, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1g, 250mg, 100mg, 10mg, 50mg, 1mg, 5 mg.
4-[(3aR,4S,9bS)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid (CAS 956189-58-5) is a chemical compound with the molecular formula C21H21NO3 and a molecular weight of 335.4 g/mol. IUPAC name: 4-[(3aR,4S,9bS)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid. InChIKey: QWJMABCFVYELBB-FRQCXROJSA-N.
| Molecular formula | C21H21NO3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-[(3aR,4S,9bS)-6-ethoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| InChIKey | QWJMABCFVYELBB-FRQCXROJSA-N |
| SMILES | CCOC1=CC=CC2=C1N[C@@H]([C@H]3[C@@H]2C=CC3)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
orb1690114