cas: 2918-83-4 — see every product listed under this CAS number, including other names
4-[(4-Hydroxyphenyl)diazenyl]benzenesulfonic Acid, ≥97%, ≥97% (CAS 2918-83-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFWQ-1g |
| cas | 2918-83-4 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 2373.20 Pln | |
| Chemat | 10g | 4542.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
4-[(4-hydroxyphenyl)diazenyl]benzenesulfonic acid (CAS 2918-83-4) is a chemical compound with the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)diazenyl]benzenesulfonic acid. InChIKey: CNYMBHPFLJWLJW-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4S |
|---|---|
| Molecular weight | 278.29 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)diazenyl]benzenesulfonic acid |
| InChIKey | CNYMBHPFLJWLJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)S(=O)(=O)O)O |
Computed by PubChem (NCBI)