cas: 676527-73-4 — see every product listed under this CAS number, including other names
4-[(4-Methylphenyl)sulfonyl]piperidinehydrochloride (CAS 676527-73-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023671-100MG |
| cas | 676527-73-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1408.90 Pln | |
| Fluorochem | 250mg | 1752.53 Pln | |
| Fluorochem | 500mg | 2439.78 Pln | |
| Fluorochem | 1g | 2955.23 Pln | |
| Fluorochem | 5g | 10775.39 Pln |
| delivery time | 2-3 weeks |
|---|
4-(4-methylphenyl)sulfonylpiperidine;hydrochloride (CAS 676527-73-4) is a chemical compound with the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. IUPAC name: 4-(4-methylphenyl)sulfonylpiperidine;hydrochloride. InChIKey: HGXSRSRLEBTQIH-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2S |
|---|---|
| Molecular weight | 275.80 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfonylpiperidine;hydrochloride |
| InChIKey | HGXSRSRLEBTQIH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2CCNCC2.Cl |
Computed by PubChem (NCBI)