CAS 1823548-94-2 appears in our catalog under these names: 4-Amino-4-benzyl-1lambda(6)-thiane-1,1-dione hydrochloride, 95%, 4-Amino-4-benzyltetrahydro-2H-thiopyran 1,1-dioxide hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-benzyl-1,1-dioxothian-4-amine;hydrochloride (CAS 1823548-94-2) is a chemical compound with the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. IUPAC name: 4-benzyl-1,1-dioxothian-4-amine;hydrochloride. InChIKey: LNLURSSZFDDBCI-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2S |
|---|---|
| Molecular weight | 275.80 g/mol |
| IUPAC name | 4-benzyl-1,1-dioxothian-4-amine;hydrochloride |
| InChIKey | LNLURSSZFDDBCI-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)