CAS 101768-74-5 appears in our catalog under these names: 3-[(Phenylsulfonyl)methyl]piperidine hydrochloride, 95%, 3-((PHenylsulfonyl)methyl)piperidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(benzenesulfonylmethyl)piperidine;hydrochloride (CAS 101768-74-5) is a chemical compound with the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. IUPAC name: 3-(benzenesulfonylmethyl)piperidine;hydrochloride. InChIKey: PKGNUPXJRWRBQJ-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2S |
|---|---|
| Molecular weight | 275.80 g/mol |
| IUPAC name | 3-(benzenesulfonylmethyl)piperidine;hydrochloride |
| InChIKey | PKGNUPXJRWRBQJ-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)CS(=O)(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)