CAS 676527-73-4 appears in our catalog under these names: 4-[(4-Methylphenyl)sulfonyl]piperidinehydrochloride, 4-[(4-Methylphenyl)sulfonyl]piperidine hydrochloride, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
4-(4-methylphenyl)sulfonylpiperidine;hydrochloride (CAS 676527-73-4) is a chemical compound with the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. IUPAC name: 4-(4-methylphenyl)sulfonylpiperidine;hydrochloride. InChIKey: HGXSRSRLEBTQIH-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2S |
|---|---|
| Molecular weight | 275.80 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfonylpiperidine;hydrochloride |
| InChIKey | HGXSRSRLEBTQIH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2CCNCC2.Cl |
Computed by PubChem (NCBI)