cas: 204320-51-4 — see every product listed under this CAS number, including other names
4-[(9H-Fluoren-9-ylmethoxy)carbonyl]morpholine-3-carboxylic Acid, >97.0%(HPLC) (CAS 204320-51-4) is a chemical reagent available from Chemat. Available pack sizes: 200mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F1050-200MG |
| cas | 204320-51-4 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 880.52 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC) |
4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid (CAS 204320-51-4) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid. InChIKey: CJVIYWXADATNKP-UHFFFAOYSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-3-carboxylic acid |
| InChIKey | CJVIYWXADATNKP-UHFFFAOYSA-N |
| SMILES | C1COCC(N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)