4-[(E)-styryl]pyridazine, 97%
cas: 35782-28-6 — see every product listed under this CAS number, including other names
4-[(E)-styryl]pyridazine, 97% (CAS 35782-28-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch138O43-100mg |
| cas | 35782-28-6 |
| size | 100mg |
| availability | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 933.20 Pln | |
| Chemat | 250mg | 1509.20 Pln | |
| Chemat | 500mg | 2138.00 Pln | |
| Chemat | 1g | 3026.00 Pln | |
| Chemat | 5g | 9242.00 Pln | |
| Fluorochem | 100mg | 1716.08 Pln | |
| Fluorochem | 250mg | 2804.24 Pln | |
| Fluorochem | 500mg | 3954.88 Pln | |
| Fluorochem | 1g | 5610.54 Pln | |
| Fluorochem | 5g | 16877.41 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[(E)-2-phenylethenyl]pyridazine (CAS 35782-28-6) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 4-[(E)-2-phenylethenyl]pyridazine. InChIKey: WHUUTUUXTSPPDS-VOTSOKGWSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 4-[(E)-2-phenylethenyl]pyridazine |
| InChIKey | WHUUTUUXTSPPDS-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CN=NC=C2 |
Computed by PubChem (NCBI)