CAS 1437-15-6 appears in our catalog under these names: 1,2-Bis(2-pyridyl)ethylene, 98%, 1,2-Di(pyridin-2-yl)ethene, ≥98%, ≥98%, Pyridine, 2,2'-(1,2-ethenediyl)bis-, ≥98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
2-[(E)-2-pyridin-2-ylethenyl]pyridine (CAS 1437-15-6) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 2-[(E)-2-pyridin-2-ylethenyl]pyridine. InChIKey: HKEOCEQLCZEBMK-BQYQJAHWSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-[(E)-2-pyridin-2-ylethenyl]pyridine |
| InChIKey | HKEOCEQLCZEBMK-BQYQJAHWSA-N |
| SMILES | C1=CC=NC(=C1)/C=C/C2=CC=CC=N2 |
Computed by PubChem (NCBI)