CAS 39816-21-2 appears in our catalog under these names: 4-(Styryl)pyrimidine, 95%, 4-(Styryl)pyrimidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-[(E)-2-phenylethenyl]pyrimidine (CAS 39816-21-2) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 4-[(E)-2-phenylethenyl]pyrimidine. InChIKey: IQRWJYZHFFPIKP-VOTSOKGWSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 4-[(E)-2-phenylethenyl]pyrimidine |
| InChIKey | IQRWJYZHFFPIKP-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=NC=NC=C2 |
Computed by PubChem (NCBI)