CAS 1551163-10-0 is the registry number for 2-(m-Tolyl)cyclopropane-1,1-dicarbonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-(3-methylphenyl)cyclopropane-1,1-dicarbonitrile (CAS 1551163-10-0) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 2-(3-methylphenyl)cyclopropane-1,1-dicarbonitrile. InChIKey: KTXADGROOVJEPC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-(3-methylphenyl)cyclopropane-1,1-dicarbonitrile |
| InChIKey | KTXADGROOVJEPC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2CC2(C#N)C#N |
Computed by PubChem (NCBI)