cas: 153559-49-0 — see every product listed under this CAS number, including other names
4-[1-(5,6,7,8-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)ethenyl]benzoic acid, 95%, 95% (CAS 153559-49-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 250mg, 1g, 100mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11490U-1mg |
| cas | 153559-49-0 |
| size | 1mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 78.80 Pln | |
| Chemat | 10mg | 117.20 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 952.40 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 5g | 3525.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Bexarotene is a member of benzoic acids, a member of naphthalenes and a retinoid. It has a role as an antineoplastic agent.
Source: ChEBI
| Molecular formula | C24H28O2 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| InChIKey | NAVMQTYZDKMPEU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=C)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)